About ethanimidate;methane
ethanimidate;methane (PubChem CID 162090399) has the molecular formula C5H16NO-
and a molecular weight of 106.19 g/mol. Its IUPAC name is ethanimidate;methane.
Molecular Properties
| Compound Name | ethanimidate;methane |
| PubChem CID | 162090399 |
| Molecular Formula | C5H16NO- |
| Molecular Weight | 106.19 g/mol |
| Exact Mass | 106.12 |
| IUPAC Name | ethanimidate;methane |
| SMILES | C.C.C.[H]/N=C(\C)[O-] |
| InChI | InChI=1S/C2H5NO.3CH4/c1-2(3)4;;;/h1H3,(H2,3,4);3*1H4/p-1 |
| InChIKey | ZDNITMMXEPKTAT-UHFFFAOYSA-M |
| XLogP | 1.25 |
| TPSA | 46.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethanimidate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanimidate;methane?
The IUPAC name of ethanimidate;methane (CID 162090399) is ethanimidate;methane.
What is the SMILES notation for ethanimidate;methane?
The canonical SMILES for ethanimidate;methane is C.C.C.[H]/N=C(\C)[O-].
What is the InChIKey of ethanimidate;methane?
The InChIKey is ZDNITMMXEPKTAT-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H5NO.3CH4/c1-2(3)4;;;/h1H3,(H2,3,4);3*1H4/p-1.
What are the key properties of ethanimidate;methane?
ethanimidate;methane has a molecular weight of 106.19 g/mol, XLogP of 1.25, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanimidate;methane is sourced from PubChem (CID 162090399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).