About azanide;cobalt(2+);ethanimidate
azanide;cobalt(2+);ethanimidate (PubChem CID 50921860) has the molecular formula C2H14CoN6O-4
and a molecular weight of 197.11 g/mol. Its IUPAC name is azanide;cobalt(2+);ethanimidate.
Molecular Properties
| Compound Name | azanide;cobalt(2+);ethanimidate |
| PubChem CID | 50921860 |
| Molecular Formula | C2H14CoN6O-4 |
| Molecular Weight | 197.11 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | azanide;cobalt(2+);ethanimidate |
| SMILES | [Co+2].[H]/N=C(\C)[O-].[NH2-].[NH2-].[NH2-].[NH2-].[NH2-] |
| InChI | InChI=1S/C2H5NO.Co.5H2N/c1-2(3)4;;;;;;/h1H3,(H2,3,4);;5*1H2/q;+2;5*-1/p-1 |
| InChIKey | ZZFAATMATRUUAA-UHFFFAOYSA-M |
| XLogP | 2.93 |
| TPSA | 214.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.11 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze azanide;cobalt(2+);ethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;cobalt(2+);ethanimidate?
The IUPAC name of azanide;cobalt(2+);ethanimidate (CID 50921860) is azanide;cobalt(2+);ethanimidate.
What is the SMILES notation for azanide;cobalt(2+);ethanimidate?
The canonical SMILES for azanide;cobalt(2+);ethanimidate is [Co+2].[H]/N=C(\C)[O-].[NH2-].[NH2-].[NH2-].[NH2-].[NH2-].
What is the InChIKey of azanide;cobalt(2+);ethanimidate?
The InChIKey is ZZFAATMATRUUAA-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H5NO.Co.5H2N/c1-2(3)4;;;;;;/h1H3,(H2,3,4);;5*1H2/q;+2;5*-1/p-1.
What are the key properties of azanide;cobalt(2+);ethanimidate?
azanide;cobalt(2+);ethanimidate has a molecular weight of 197.11 g/mol, XLogP of 2.93, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;cobalt(2+);ethanimidate is sourced from PubChem (CID 50921860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).