About 2-iminopentan-3-one;methanol
2-iminopentan-3-one;methanol (PubChem CID 144635571) has the molecular formula C6H13NO2
and a molecular weight of 131.17 g/mol. Its IUPAC name is 2-iminopentan-3-one;methanol.
Molecular Properties
| Compound Name | 2-iminopentan-3-one;methanol |
| PubChem CID | 144635571 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | 2-iminopentan-3-one;methanol |
| SMILES | CO.[H]/N=C(\C)C(=O)CC |
| InChI | InChI=1S/C5H9NO.CH4O/c1-3-5(7)4(2)6;1-2/h6H,3H2,1-2H3;2H,1H3/b6-4+; |
| InChIKey | WUANORNOOBBCIQ-CVDVRWGVSA-N |
| XLogP | 0.61 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-iminopentan-3-one;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iminopentan-3-one;methanol?
The IUPAC name of 2-iminopentan-3-one;methanol (CID 144635571) is 2-iminopentan-3-one;methanol.
What is the SMILES notation for 2-iminopentan-3-one;methanol?
The canonical SMILES for 2-iminopentan-3-one;methanol is CO.[H]/N=C(\C)C(=O)CC.
What is the InChIKey of 2-iminopentan-3-one;methanol?
The InChIKey is WUANORNOOBBCIQ-CVDVRWGVSA-N. The full InChI is InChI=1S/C5H9NO.CH4O/c1-3-5(7)4(2)6;1-2/h6H,3H2,1-2H3;2H,1H3/b6-4+;.
What are the key properties of 2-iminopentan-3-one;methanol?
2-iminopentan-3-one;methanol has a molecular weight of 131.17 g/mol, XLogP of 0.61, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminopentan-3-one;methanol is sourced from PubChem (CID 144635571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).