C5H14N4 — CID 176546052
methane;1-(propan-2-ylideneamino)guanidine (PubChem CID 176546052) has the molecular formula C5H14N4 and a molecular weight of 130.19 g/mol. Its IUPAC name is methane;1-(propan-2-ylideneamino)guanidine.
| Compound Name | methane;1-(propan-2-ylideneamino)guanidine |
|---|---|
| PubChem CID | 176546052 |
| Molecular Formula | C5H14N4 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.12 |
| IUPAC Name | methane;1-(propan-2-ylideneamino)guanidine |
| SMILES | C.[H]/N=C(\N)NN=C(C)C |
| InChI | InChI=1S/C4H10N4.CH4/c1-3(2)7-8-4(5)6;/h1-2H3,(H4,5,6,8);1H4 |
| InChIKey | RFYYWJLHQZLCSG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|