C7H16N4 — CID 176525594
1-[(E)-3,3-dimethylbutan-2-ylideneamino]guanidine (PubChem CID 176525594) has the molecular formula C7H16N4 and a molecular weight of 156.23 g/mol. Its IUPAC name is 1-[(E)-3,3-dimethylbutan-2-ylideneamino]guanidine.
| Compound Name | 1-[(E)-3,3-dimethylbutan-2-ylideneamino]guanidine |
|---|---|
| PubChem CID | 176525594 |
| Molecular Formula | C7H16N4 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.14 |
| IUPAC Name | 1-[(E)-3,3-dimethylbutan-2-ylideneamino]guanidine |
| SMILES | [H]/N=C(\N)N/N=C(\C)C(C)(C)C |
| InChI | InChI=1S/C7H16N4/c1-5(7(2,3)4)10-11-6(8)9/h1-4H3,(H4,8,9,11)/b10-5+ |
| InChIKey | SAMZZOGHXPPJJV-BJMVGYQFSA-N |
| XLogP | 0.89 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|