C4H9Cl2N5 — CID 176527824
1-carbamimidoyl-2-(1,1-dichloroethyl)guanidine (PubChem CID 176527824) has the molecular formula C4H9Cl2N5 and a molecular weight of 198.06 g/mol. Its IUPAC name is 1-carbamimidoyl-2-(1,1-dichloroethyl)guanidine.
| Compound Name | 1-carbamimidoyl-2-(1,1-dichloroethyl)guanidine |
|---|---|
| PubChem CID | 176527824 |
| Molecular Formula | C4H9Cl2N5 |
| Molecular Weight | 198.06 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 1-carbamimidoyl-2-(1,1-dichloroethyl)guanidine |
| SMILES | [H]/N=C(\N)NC(N)=NC(C)(Cl)Cl |
| InChI | InChI=1S/C4H9Cl2N5/c1-4(5,6)11-3(9)10-2(7)8/h1H3,(H6,7,8,9,10,11) |
| InChIKey | QFKMKKQAQCECLW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.06 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|