C9H22N6 — CID 176546798
1-carbamimidoyl-2-[3-(dimethylamino)-2,2-dimethylpropyl]guanidine (PubChem CID 176546798) has the molecular formula C9H22N6 and a molecular weight of 214.32 g/mol. Its IUPAC name is 1-carbamimidoyl-2-[3-(dimethylamino)-2,2-dimethylpropyl]guanidine.
| Compound Name | 1-carbamimidoyl-2-[3-(dimethylamino)-2,2-dimethylpropyl]guanidine |
|---|---|
| PubChem CID | 176546798 |
| Molecular Formula | C9H22N6 |
| Molecular Weight | 214.32 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 1-carbamimidoyl-2-[3-(dimethylamino)-2,2-dimethylpropyl]guanidine |
| SMILES | [H]/N=C(\N)N/C(N)=N/CC(C)(C)CN(C)C |
| InChI | InChI=1S/C9H22N6/c1-9(2,6-15(3)4)5-13-8(12)14-7(10)11/h5-6H2,1-4H3,(H6,10,11,12,13,14) |
| InChIKey | DZIQPEFNRGSIHP-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 103.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.32 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|