C6H13ClN6 — CID 176526326
1-carbamimidoyl-2-(2-cyanopropan-2-yl)guanidine;hydrochloride (PubChem CID 176526326) has the molecular formula C6H13ClN6 and a molecular weight of 204.67 g/mol. Its IUPAC name is 1-carbamimidoyl-2-(2-cyanopropan-2-yl)guanidine;hydrochloride.
| Compound Name | 1-carbamimidoyl-2-(2-cyanopropan-2-yl)guanidine;hydrochloride |
|---|---|
| PubChem CID | 176526326 |
| Molecular Formula | C6H13ClN6 |
| Molecular Weight | 204.67 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 1-carbamimidoyl-2-(2-cyanopropan-2-yl)guanidine;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N/C(N)=N/C(C)(C)C#N |
| InChI | InChI=1S/C6H12N6.ClH/c1-6(2,3-7)12-5(10)11-4(8)9;/h1-2H3,(H6,8,9,10,11,12);1H |
| InChIKey | XCQMHCPDEBRYSQ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 124.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.67 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|