C4H9N3 — CID 123340860
2,3-diiminobutan-1-amine (PubChem CID 123340860) has the molecular formula C4H9N3 and a molecular weight of 99.14 g/mol. Its IUPAC name is 2,3-diiminobutan-1-amine.
| Compound Name | 2,3-diiminobutan-1-amine |
|---|---|
| PubChem CID | 123340860 |
| Molecular Formula | C4H9N3 |
| Molecular Weight | 99.14 g/mol |
| Exact Mass | 99.08 |
| IUPAC Name | 2,3-diiminobutan-1-amine |
| SMILES | [H]/N=C(C)/C(CN)=N/[H] |
| InChI | InChI=1S/C4H9N3/c1-3(6)4(7)2-5/h6-7H,2,5H2,1H3/b6-3+,7-4+ |
| InChIKey | MZRNPHYWTGTLRR-XOKGJFMYSA-N |
| XLogP | 0.00 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 99.14 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|