C8H18N2 — CID 144731148
(3Z)-penta-1,3-diene-2,4-diamine;propane (PubChem CID 144731148) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is (3Z)-penta-1,3-diene-2,4-diamine;propane.
| Compound Name | (3Z)-penta-1,3-diene-2,4-diamine;propane |
|---|---|
| PubChem CID | 144731148 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | (3Z)-penta-1,3-diene-2,4-diamine;propane |
| SMILES | C=C(N)/C=C(/C)N.CCC |
| InChI | InChI=1S/C5H10N2.C3H8/c1-4(6)3-5(2)7;1-3-2/h3H,1,6-7H2,2H3;3H2,1-2H3/b5-3-; |
| InChIKey | MWXYUZPRMMCJEW-FBZPGIPVSA-N |
| XLogP | 1.74 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|