C9H15N — CID 169247779
(2E,5Z)-5-methyl-4-methylidenehepta-2,5-dien-2-amine (PubChem CID 169247779) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is (2E,5Z)-5-methyl-4-methylidenehepta-2,5-dien-2-amine.
| Compound Name | (2E,5Z)-5-methyl-4-methylidenehepta-2,5-dien-2-amine |
|---|---|
| PubChem CID | 169247779 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (2E,5Z)-5-methyl-4-methylidenehepta-2,5-dien-2-amine |
| SMILES | C=C(/C=C(\C)N)/C(C)=C\C |
| InChI | InChI=1S/C9H15N/c1-5-7(2)8(3)6-9(4)10/h5-6H,3,10H2,1-2,4H3/b7-5-,9-6+ |
| InChIKey | QKJOFDHQZNZSIY-XCZNYUDNSA-N |
| XLogP | 2.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|