C7H15NSi — CID 174949270
2,3-dimethyl-1-silylpenta-1,3-dien-1-amine (PubChem CID 174949270) has the molecular formula C7H15NSi and a molecular weight of 141.29 g/mol. Its IUPAC name is 2,3-dimethyl-1-silylpenta-1,3-dien-1-amine.
| Compound Name | 2,3-dimethyl-1-silylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 174949270 |
| Molecular Formula | C7H15NSi |
| Molecular Weight | 141.29 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | 2,3-dimethyl-1-silylpenta-1,3-dien-1-amine |
| SMILES | CC=C(C)C(C)=C(N)[SiH3] |
| InChI | InChI=1S/C7H15NSi/c1-4-5(2)6(3)7(8)9/h4H,8H2,1-3,9H3 |
| InChIKey | YXQDDLFHRJRCQF-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.29 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|