C9H15Cl — CID 5466616
(2E,4Z)-5-chloro-3,4-dimethylhepta-2,4-diene (PubChem CID 5466616) has the molecular formula C9H15Cl and a molecular weight of 158.67 g/mol. Its IUPAC name is (2E,4Z)-5-chloro-3,4-dimethylhepta-2,4-diene.
| Compound Name | (2E,4Z)-5-chloro-3,4-dimethylhepta-2,4-diene |
|---|---|
| PubChem CID | 5466616 |
| Molecular Formula | C9H15Cl |
| Molecular Weight | 158.67 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (2E,4Z)-5-chloro-3,4-dimethylhepta-2,4-diene |
| SMILES | C/C=C(C)/C(C)=C(\Cl)CC |
| InChI | InChI=1S/C9H15Cl/c1-5-7(3)8(4)9(10)6-2/h5H,6H2,1-4H3/b7-5+,9-8- |
| InChIKey | FTVRCVPBCUYCEF-WGKMIZOUSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.67 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|