C7H11Cl — CID 144881420
(2E,4E)-3-chloro-4-methylhexa-2,4-diene (PubChem CID 144881420) has the molecular formula C7H11Cl and a molecular weight of 130.62 g/mol. Its IUPAC name is (2E,4E)-3-chloro-4-methylhexa-2,4-diene.
| Compound Name | (2E,4E)-3-chloro-4-methylhexa-2,4-diene |
|---|---|
| PubChem CID | 144881420 |
| Molecular Formula | C7H11Cl |
| Molecular Weight | 130.62 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | (2E,4E)-3-chloro-4-methylhexa-2,4-diene |
| SMILES | C/C=C(C)/C(Cl)=C\C |
| InChI | InChI=1S/C7H11Cl/c1-4-6(3)7(8)5-2/h4-5H,1-3H3/b6-4+,7-5+ |
| InChIKey | JOUYMKILPIPNHT-YDFGWWAZSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.62 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|