C5H6ClF — CID 143057342
(3E)-3-chloro-2-fluoropenta-1,3-diene (PubChem CID 143057342) has the molecular formula C5H6ClF and a molecular weight of 120.55 g/mol. Its IUPAC name is (3E)-3-chloro-2-fluoropenta-1,3-diene.
| Compound Name | (3E)-3-chloro-2-fluoropenta-1,3-diene |
|---|---|
| PubChem CID | 143057342 |
| Molecular Formula | C5H6ClF |
| Molecular Weight | 120.55 g/mol |
| Exact Mass | 120.01 |
| IUPAC Name | (3E)-3-chloro-2-fluoropenta-1,3-diene |
| SMILES | C=C(F)/C(Cl)=C\C |
| InChI | InChI=1S/C5H6ClF/c1-3-5(6)4(2)7/h3H,2H2,1H3/b5-3+ |
| InChIKey | MZCJIEMMPGOPIW-HWKANZROSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.55 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|