C7H7ClF2 — CID 144827256
(3Z)-3-chloro-2,4-difluoro-5-methylhexa-1,3,5-triene (PubChem CID 144827256) has the molecular formula C7H7ClF2 and a molecular weight of 164.58 g/mol. Its IUPAC name is (3Z)-3-chloro-2,4-difluoro-5-methylhexa-1,3,5-triene.
| Compound Name | (3Z)-3-chloro-2,4-difluoro-5-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 144827256 |
| Molecular Formula | C7H7ClF2 |
| Molecular Weight | 164.58 g/mol |
| Exact Mass | 164.02 |
| IUPAC Name | (3Z)-3-chloro-2,4-difluoro-5-methylhexa-1,3,5-triene |
| SMILES | C=C(C)/C(F)=C(/Cl)C(=C)F |
| InChI | InChI=1S/C7H7ClF2/c1-4(2)7(10)6(8)5(3)9/h1,3H2,2H3/b7-6- |
| InChIKey | ZSHKLBLODZLPKD-SREVYHEPSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.58 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|