C8H16 — CID 156868132
2,3-dimethylbuta-1,3-diene;ethane (PubChem CID 156868132) has the molecular formula C8H16 and a molecular weight of 112.22 g/mol. Its IUPAC name is 2,3-dimethylbuta-1,3-diene;ethane.
| Compound Name | 2,3-dimethylbuta-1,3-diene;ethane |
|---|---|
| PubChem CID | 156868132 |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.22 g/mol |
| Exact Mass | 112.13 |
| IUPAC Name | 2,3-dimethylbuta-1,3-diene;ethane |
| SMILES | C=C(C)C(=C)C.CC |
| InChI | InChI=1S/C6H10.C2H6/c1-5(2)6(3)4;1-2/h1,3H2,2,4H3;1-2H3 |
| InChIKey | IPBYHQYLMWPQQP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|