About butane;ethane;2-methylprop-1-ene
butane;ethane;2-methylprop-1-ene (PubChem CID 142168819) has the molecular formula C12H30
and a molecular weight of 174.37 g/mol. Its IUPAC name is butane;ethane;2-methylprop-1-ene.
Molecular Properties
| Compound Name | butane;ethane;2-methylprop-1-ene |
| PubChem CID | 142168819 |
| Molecular Formula | C12H30 |
| Molecular Weight | 174.37 g/mol |
| Exact Mass | 174.23 |
| IUPAC Name | butane;ethane;2-methylprop-1-ene |
| SMILES | C=C(C)C.CC.CC.CCCC |
| InChI | InChI=1S/C4H8.C4H10.2C2H6/c1-4(2)3;1-3-4-2;2*1-2/h1H2,2-3H3;3-4H2,1-2H3;2*1-2H3 |
| InChIKey | GITOJDIWQZJGJF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 174.37 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butane;ethane;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;ethane;2-methylprop-1-ene?
The IUPAC name of butane;ethane;2-methylprop-1-ene (CID 142168819) is butane;ethane;2-methylprop-1-ene.
What is the SMILES notation for butane;ethane;2-methylprop-1-ene?
The canonical SMILES for butane;ethane;2-methylprop-1-ene is C=C(C)C.CC.CC.CCCC.
What is the InChIKey of butane;ethane;2-methylprop-1-ene?
The InChIKey is GITOJDIWQZJGJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8.C4H10.2C2H6/c1-4(2)3;1-3-4-2;2*1-2/h1H2,2-3H3;3-4H2,1-2H3;2*1-2H3.
What are the key properties of butane;ethane;2-methylprop-1-ene?
butane;ethane;2-methylprop-1-ene has a molecular weight of 174.37 g/mol, XLogP of 5.44, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;ethane;2-methylprop-1-ene is sourced from PubChem (CID 142168819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).