About butane;2-methylbut-1-en-3-yne
butane;2-methylbut-1-en-3-yne (PubChem CID 145419919) has the molecular formula C9H16
and a molecular weight of 124.23 g/mol. Its IUPAC name is butane;2-methylbut-1-en-3-yne.
Molecular Properties
| Compound Name | butane;2-methylbut-1-en-3-yne |
| PubChem CID | 145419919 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | butane;2-methylbut-1-en-3-yne |
| SMILES | C#CC(=C)C.CCCC |
| InChI | InChI=1S/C5H6.C4H10/c1-4-5(2)3;1-3-4-2/h1H,2H2,3H3;3-4H2,1-2H3 |
| InChIKey | BMWKOBYEMDRLPY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze butane;2-methylbut-1-en-3-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;2-methylbut-1-en-3-yne?
The IUPAC name of butane;2-methylbut-1-en-3-yne (CID 145419919) is butane;2-methylbut-1-en-3-yne.
What is the SMILES notation for butane;2-methylbut-1-en-3-yne?
The canonical SMILES for butane;2-methylbut-1-en-3-yne is C#CC(=C)C.CCCC.
What is the InChIKey of butane;2-methylbut-1-en-3-yne?
The InChIKey is BMWKOBYEMDRLPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6.C4H10/c1-4-5(2)3;1-3-4-2/h1H,2H2,3H3;3-4H2,1-2H3.
What are the key properties of butane;2-methylbut-1-en-3-yne?
butane;2-methylbut-1-en-3-yne has a molecular weight of 124.23 g/mol, XLogP of 3.00, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;2-methylbut-1-en-3-yne is sourced from PubChem (CID 145419919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).