C11H22 — CID 145158115
butane;3-methylhexa-1,2-diene (PubChem CID 145158115) has the molecular formula C11H22 and a molecular weight of 154.30 g/mol. Its IUPAC name is butane;3-methylhexa-1,2-diene.
| Compound Name | butane;3-methylhexa-1,2-diene |
|---|---|
| PubChem CID | 145158115 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | butane;3-methylhexa-1,2-diene |
| SMILES | C=C=C(C)CCC.CCCC |
| InChI | InChI=1S/C7H12.C4H10/c1-4-6-7(3)5-2;1-3-4-2/h2,4,6H2,1,3H3;3-4H2,1-2H3 |
| InChIKey | QNMZXUJTBIPVTA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |