About fluoroethane;3-methylbuta-1,2-diene
fluoroethane;3-methylbuta-1,2-diene (PubChem CID 143722079) has the molecular formula C7H13F
and a molecular weight of 116.18 g/mol. Its IUPAC name is fluoroethane;3-methylbuta-1,2-diene.
Molecular Properties
| Compound Name | fluoroethane;3-methylbuta-1,2-diene |
| PubChem CID | 143722079 |
| Molecular Formula | C7H13F |
| Molecular Weight | 116.18 g/mol |
| Exact Mass | 116.10 |
| IUPAC Name | fluoroethane;3-methylbuta-1,2-diene |
| SMILES | C=C=C(C)C.CCF |
| InChI | InChI=1S/C5H8.C2H5F/c1-4-5(2)3;1-2-3/h1H2,2-3H3;2H2,1H3 |
| InChIKey | OPNYFZHBHNRGLV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.18 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze fluoroethane;3-methylbuta-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroethane;3-methylbuta-1,2-diene?
The IUPAC name of fluoroethane;3-methylbuta-1,2-diene (CID 143722079) is fluoroethane;3-methylbuta-1,2-diene.
What is the SMILES notation for fluoroethane;3-methylbuta-1,2-diene?
The canonical SMILES for fluoroethane;3-methylbuta-1,2-diene is C=C=C(C)C.CCF.
What is the InChIKey of fluoroethane;3-methylbuta-1,2-diene?
The InChIKey is OPNYFZHBHNRGLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8.C2H5F/c1-4-5(2)3;1-2-3/h1H2,2-3H3;2H2,1H3.
What are the key properties of fluoroethane;3-methylbuta-1,2-diene?
fluoroethane;3-methylbuta-1,2-diene has a molecular weight of 116.18 g/mol, XLogP of 2.71, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroethane;3-methylbuta-1,2-diene is sourced from PubChem (CID 143722079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).