C4H5F2Li — CID 174951688
lithium;3,4-difluorobuta-1,2-diene;hydride (PubChem CID 174951688) has the molecular formula C4H5F2Li and a molecular weight of 98.02 g/mol. Its IUPAC name is lithium;3,4-difluorobuta-1,2-diene;hydride.
| Compound Name | lithium;3,4-difluorobuta-1,2-diene;hydride |
|---|---|
| PubChem CID | 174951688 |
| Molecular Formula | C4H5F2Li |
| Molecular Weight | 98.02 g/mol |
| Exact Mass | 98.05 |
| IUPAC Name | lithium;3,4-difluorobuta-1,2-diene;hydride |
| SMILES | C=C=C(F)CF.[H-].[Li+] |
| InChI | InChI=1S/C4H4F2.Li.H/c1-2-4(6)3-5;;/h1,3H2;;/q;+1;-1 |
| InChIKey | ZNMGSCIUWYYEJS-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.02 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |