C7H6F6 — CID 139662530
3,4,4,5,5,7-hexafluorohepta-1,2-diene (PubChem CID 139662530) has the molecular formula C7H6F6 and a molecular weight of 204.11 g/mol. Its IUPAC name is 3,4,4,5,5,7-hexafluorohepta-1,2-diene.
| Compound Name | 3,4,4,5,5,7-hexafluorohepta-1,2-diene |
|---|---|
| PubChem CID | 139662530 |
| Molecular Formula | C7H6F6 |
| Molecular Weight | 204.11 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 3,4,4,5,5,7-hexafluorohepta-1,2-diene |
| SMILES | C=C=C(F)C(F)(F)C(F)(F)CCF |
| InChI | InChI=1S/C7H6F6/c1-2-5(9)7(12,13)6(10,11)3-4-8/h1,3-4H2 |
| InChIKey | VEMKXBSUNORJJT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.11 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|