About 2-(2-fluoroethyl)-2-(3,3,3-trifluoropropyl)propanedinitrile
2-(2-fluoroethyl)-2-(3,3,3-trifluoropropyl)propanedinitrile (PubChem CID 87395428) has the molecular formula C8H8F4N2
and a molecular weight of 208.16 g/mol. Its IUPAC name is 2-(2-fluoroethyl)-2-(3,3,3-trifluoropropyl)propanedinitrile.
Molecular Properties
| Compound Name | 2-(2-fluoroethyl)-2-(3,3,3-trifluoropropyl)propanedinitrile |
| PubChem CID | 87395428 |
| Molecular Formula | C8H8F4N2 |
| Molecular Weight | 208.16 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 2-(2-fluoroethyl)-2-(3,3,3-trifluoropropyl)propanedinitrile |
| SMILES | N#CC(C#N)(CCF)CCC(F)(F)F |
| InChI | InChI=1S/C8H8F4N2/c9-4-3-7(5-13,6-14)1-2-8(10,11)12/h1-4H2 |
| InChIKey | HPHOGFYYQUUXJW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.16 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-fluoroethyl)-2-(3,3,3-trifluoropropyl)propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluoroethyl)-2-(3,3,3-trifluoropropyl)propanedinitrile?
The IUPAC name of 2-(2-fluoroethyl)-2-(3,3,3-trifluoropropyl)propanedinitrile (CID 87395428) is 2-(2-fluoroethyl)-2-(3,3,3-trifluoropropyl)propanedinitrile.
What is the SMILES notation for 2-(2-fluoroethyl)-2-(3,3,3-trifluoropropyl)propanedinitrile?
The canonical SMILES for 2-(2-fluoroethyl)-2-(3,3,3-trifluoropropyl)propanedinitrile is N#CC(C#N)(CCF)CCC(F)(F)F.
What is the InChIKey of 2-(2-fluoroethyl)-2-(3,3,3-trifluoropropyl)propanedinitrile?
The InChIKey is HPHOGFYYQUUXJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F4N2/c9-4-3-7(5-13,6-14)1-2-8(10,11)12/h1-4H2.
What are the key properties of 2-(2-fluoroethyl)-2-(3,3,3-trifluoropropyl)propanedinitrile?
2-(2-fluoroethyl)-2-(3,3,3-trifluoropropyl)propanedinitrile has a molecular weight of 208.16 g/mol, XLogP of 2.72, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluoroethyl)-2-(3,3,3-trifluoropropyl)propanedinitrile is sourced from PubChem (CID 87395428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).