C11H6F12N2 — CID 58879049
2-(3,3,4,4,5,5,5-heptafluoropentyl)-2-(2,2,3,3,3-pentafluoropropyl)propanedinitrile (PubChem CID 58879049) has the molecular formula C11H6F12N2 and a molecular weight of 394.16 g/mol. Its IUPAC name is 2-(3,3,4,4,5,5,5-heptafluoropentyl)-2-(2,2,3,3,3-pentafluoropropyl)propanedinitrile.
| Compound Name | 2-(3,3,4,4,5,5,5-heptafluoropentyl)-2-(2,2,3,3,3-pentafluoropropyl)propanedinitrile |
|---|---|
| PubChem CID | 58879049 |
| Molecular Formula | C11H6F12N2 |
| Molecular Weight | 394.16 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 2-(3,3,4,4,5,5,5-heptafluoropentyl)-2-(2,2,3,3,3-pentafluoropropyl)propanedinitrile |
| SMILES | N#CC(C#N)(CCC(F)(F)C(F)(F)C(F)(F)F)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H6F12N2/c12-7(13,9(16,17)11(21,22)23)2-1-6(4-24,5-25)3-8(14,15)10(18,19)20/h1-3H2 |
| InChIKey | XMZFGXFMJDVGMZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.16 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|