About 1,1,1,4-tetrafluoro-2,2-bis(trifluoromethyl)butane
1,1,1,4-tetrafluoro-2,2-bis(trifluoromethyl)butane (PubChem CID 177246313) has the molecular formula C6H4F10
and a molecular weight of 266.08 g/mol. Its IUPAC name is 1,1,1,4-tetrafluoro-2,2-bis(trifluoromethyl)butane.
Analyze 1,1,1,4-tetrafluoro-2,2-bis(trifluoromethyl)butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,1,4-tetrafluoro-2,2-bis(trifluoromethyl)butane?
The IUPAC name of 1,1,1,4-tetrafluoro-2,2-bis(trifluoromethyl)butane (CID 177246313) is 1,1,1,4-tetrafluoro-2,2-bis(trifluoromethyl)butane.
What is the SMILES notation for 1,1,1,4-tetrafluoro-2,2-bis(trifluoromethyl)butane?
The canonical SMILES for 1,1,1,4-tetrafluoro-2,2-bis(trifluoromethyl)butane is FCCC(C(F)(F)F)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 1,1,1,4-tetrafluoro-2,2-bis(trifluoromethyl)butane?
The InChIKey is RJNCUFUOXHRPOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F10/c7-2-1-3(4(8,9)10,5(11,12)13)6(14,15)16/h1-2H2.
What are the key properties of 1,1,1,4-tetrafluoro-2,2-bis(trifluoromethyl)butane?
1,1,1,4-tetrafluoro-2,2-bis(trifluoromethyl)butane has a molecular weight of 266.08 g/mol, XLogP of 4.02, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,1,4-tetrafluoro-2,2-bis(trifluoromethyl)butane is sourced from PubChem (CID 177246313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).