C7H5F11O — CID 139735073
3,3,5,5,5-pentafluoro-2,2-bis(trifluoromethyl)pentan-1-ol (PubChem CID 139735073) has the molecular formula C7H5F11O and a molecular weight of 314.09 g/mol. Its IUPAC name is 3,3,5,5,5-pentafluoro-2,2-bis(trifluoromethyl)pentan-1-ol.
| Compound Name | 3,3,5,5,5-pentafluoro-2,2-bis(trifluoromethyl)pentan-1-ol |
|---|---|
| PubChem CID | 139735073 |
| Molecular Formula | C7H5F11O |
| Molecular Weight | 314.09 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 3,3,5,5,5-pentafluoro-2,2-bis(trifluoromethyl)pentan-1-ol |
| SMILES | OCC(C(F)(F)F)(C(F)(F)F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C7H5F11O/c8-4(9,1-5(10,11)12)3(2-19,6(13,14)15)7(16,17)18/h19H,1-2H2 |
| InChIKey | RTSSOKSWNOZVPT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.09 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |