C12H4F22O — CID 175373281
2-[difluoro-[1,1,2,3,3,5,5,5-octafluoro-2-(trifluoromethyl)pentoxy]methyl]-1,1,1,2,3,3,5,5,5-nonafluoropentane (PubChem CID 175373281) has the molecular formula C12H4F22O and a molecular weight of 582.12 g/mol. Its IUPAC name is 2-[difluoro-[1,1,2,3,3,5,5,5-octafluoro-2-(trifluoromethyl)pentoxy]methyl]-1,1,1,2,3,3,5,5,5-nonafluoropentane.
| Compound Name | 2-[difluoro-[1,1,2,3,3,5,5,5-octafluoro-2-(trifluoromethyl)pentoxy]methyl]-1,1,1,2,3,3,5,5,5-nonafluoropentane |
|---|---|
| PubChem CID | 175373281 |
| Molecular Formula | C12H4F22O |
| Molecular Weight | 582.12 g/mol |
| Exact Mass | 581.99 |
| IUPAC Name | 2-[difluoro-[1,1,2,3,3,5,5,5-octafluoro-2-(trifluoromethyl)pentoxy]methyl]-1,1,1,2,3,3,5,5,5-nonafluoropentane |
| SMILES | FC(F)(F)CC(F)(F)C(F)(C(F)(F)F)C(F)(F)OC(F)(F)C(F)(C(F)(F)F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C12H4F22O/c13-3(14,1-5(17,18)19)7(23,9(25,26)27)11(31,32)35-12(33,34)8(24,10(28,29)30)4(15,16)2-6(20,21)22/h1-2H2 |
| InChIKey | DSZYWCRRABLMSK-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.12 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |