C8H4Cl2F12O — CID 151942981
2-(chloromethyl)-1-[2-(chloromethyl)-1,1,2,3,3,3-hexafluoropropoxy]-1,1,2,3,3,3-hexafluoropropane (PubChem CID 151942981) has the molecular formula C8H4Cl2F12O and a molecular weight of 415.00 g/mol. Its IUPAC name is 2-(chloromethyl)-1-[2-(chloromethyl)-1,1,2,3,3,3-hexafluoropropoxy]-1,1,2,3,3,3-hexafluoropropane.
| Compound Name | 2-(chloromethyl)-1-[2-(chloromethyl)-1,1,2,3,3,3-hexafluoropropoxy]-1,1,2,3,3,3-hexafluoropropane |
|---|---|
| PubChem CID | 151942981 |
| Molecular Formula | C8H4Cl2F12O |
| Molecular Weight | 415.00 g/mol |
| Exact Mass | 413.94 |
| IUPAC Name | 2-(chloromethyl)-1-[2-(chloromethyl)-1,1,2,3,3,3-hexafluoropropoxy]-1,1,2,3,3,3-hexafluoropropane |
| SMILES | FC(F)(F)C(F)(CCl)C(F)(F)OC(F)(F)C(F)(CCl)C(F)(F)F |
| InChI | InChI=1S/C8H4Cl2F12O/c9-1-3(11,5(13,14)15)7(19,20)23-8(21,22)4(12,2-10)6(16,17)18/h1-2H2 |
| InChIKey | TVBFQTUWGGKJRR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.00 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|