C8Cl4F14O — CID 22001044
1,1-dichloro-4-(4,4-dichloro-1,1,2,2,3,3,4-heptafluorobutoxy)-1,2,2,3,3,4,4-heptafluorobutane (PubChem CID 22001044) has the molecular formula C8Cl4F14O and a molecular weight of 519.87 g/mol. Its IUPAC name is 1,1-dichloro-4-(4,4-dichloro-1,1,2,2,3,3,4-heptafluorobutoxy)-1,2,2,3,3,4,4-heptafluorobutane.
| Compound Name | 1,1-dichloro-4-(4,4-dichloro-1,1,2,2,3,3,4-heptafluorobutoxy)-1,2,2,3,3,4,4-heptafluorobutane |
|---|---|
| PubChem CID | 22001044 |
| Molecular Formula | C8Cl4F14O |
| Molecular Weight | 519.87 g/mol |
| Exact Mass | 517.85 |
| IUPAC Name | 1,1-dichloro-4-(4,4-dichloro-1,1,2,2,3,3,4-heptafluorobutoxy)-1,2,2,3,3,4,4-heptafluorobutane |
| SMILES | FC(Cl)(Cl)C(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(Cl)Cl |
| InChI | InChI=1S/C8Cl4F14O/c9-5(10,21)1(13,14)3(17,18)7(23,24)27-8(25,26)4(19,20)2(15,16)6(11,12)22 |
| InChIKey | XLHQMWKXRIHHSX-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.87 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|