C8H6F12O — CID 87322712
1,1,2,2,4,4-hexafluoro-1-(1,1,2,2,4,4-hexafluorobutoxy)butane (PubChem CID 87322712) has the molecular formula C8H6F12O and a molecular weight of 346.11 g/mol. Its IUPAC name is 1,1,2,2,4,4-hexafluoro-1-(1,1,2,2,4,4-hexafluorobutoxy)butane.
| Compound Name | 1,1,2,2,4,4-hexafluoro-1-(1,1,2,2,4,4-hexafluorobutoxy)butane |
|---|---|
| PubChem CID | 87322712 |
| Molecular Formula | C8H6F12O |
| Molecular Weight | 346.11 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 1,1,2,2,4,4-hexafluoro-1-(1,1,2,2,4,4-hexafluorobutoxy)butane |
| SMILES | FC(F)CC(F)(F)C(F)(F)OC(F)(F)C(F)(F)CC(F)F |
| InChI | InChI=1S/C8H6F12O/c9-3(10)1-5(13,14)7(17,18)21-8(19,20)6(15,16)2-4(11)12/h3-4H,1-2H2 |
| InChIKey | MTZDUAMDPDYGTK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.11 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|