C9H7F14O4P — CID 175360213
bis(1,1,2,2,4,4,4-heptafluorobutoxy)phosphorylmethanol (PubChem CID 175360213) has the molecular formula C9H7F14O4P and a molecular weight of 476.10 g/mol. Its IUPAC name is bis(1,1,2,2,4,4,4-heptafluorobutoxy)phosphorylmethanol.
| Compound Name | bis(1,1,2,2,4,4,4-heptafluorobutoxy)phosphorylmethanol |
|---|---|
| PubChem CID | 175360213 |
| Molecular Formula | C9H7F14O4P |
| Molecular Weight | 476.10 g/mol |
| Exact Mass | 475.99 |
| IUPAC Name | bis(1,1,2,2,4,4,4-heptafluorobutoxy)phosphorylmethanol |
| SMILES | O=P(CO)(OC(F)(F)C(F)(F)CC(F)(F)F)OC(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C9H7F14O4P/c10-4(11,1-6(14,15)16)8(20,21)26-28(25,3-24)27-9(22,23)5(12,13)2-7(17,18)19/h24H,1-3H2 |
| InChIKey | ULYCJMHNYAYGGH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.10 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|