C8H8F7NO — CID 173480202
4,4,5,5,7,7,7-heptafluoro-2-methylhept-2-enamide (PubChem CID 173480202) has the molecular formula C8H8F7NO and a molecular weight of 267.14 g/mol. Its IUPAC name is 4,4,5,5,7,7,7-heptafluoro-2-methylhept-2-enamide.
| Compound Name | 4,4,5,5,7,7,7-heptafluoro-2-methylhept-2-enamide |
|---|---|
| PubChem CID | 173480202 |
| Molecular Formula | C8H8F7NO |
| Molecular Weight | 267.14 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 4,4,5,5,7,7,7-heptafluoro-2-methylhept-2-enamide |
| SMILES | CC(=CC(F)(F)C(F)(F)CC(F)(F)F)C(N)=O |
| InChI | InChI=1S/C8H8F7NO/c1-4(5(16)17)2-6(9,10)7(11,12)3-8(13,14)15/h2H,3H2,1H3,(H2,16,17) |
| InChIKey | UPLQBVBFUPLMCB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.14 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|