C10H12F6O2 — CID 87262359
4,4,5,5,6,6-hexafluoro-2-methylnon-2-enoic acid (PubChem CID 87262359) has the molecular formula C10H12F6O2 and a molecular weight of 278.19 g/mol. Its IUPAC name is 4,4,5,5,6,6-hexafluoro-2-methylnon-2-enoic acid.
| Compound Name | 4,4,5,5,6,6-hexafluoro-2-methylnon-2-enoic acid |
|---|---|
| PubChem CID | 87262359 |
| Molecular Formula | C10H12F6O2 |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 4,4,5,5,6,6-hexafluoro-2-methylnon-2-enoic acid |
| SMILES | CCCC(F)(F)C(F)(F)C(F)(F)C=C(C)C(=O)O |
| InChI | InChI=1S/C10H12F6O2/c1-3-4-8(11,12)10(15,16)9(13,14)5-6(2)7(17)18/h5H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | CQDCRELXDMVDPH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|