C17H23F8NO4 — CID 87655313
5-(dimethylamino)-2-methylidenepentanoic acid;4,4,5,5,6,6,7,7-octafluoro-2-methyloct-2-enoic acid (PubChem CID 87655313) has the molecular formula C17H23F8NO4 and a molecular weight of 457.36 g/mol. Its IUPAC name is 5-(dimethylamino)-2-methylidenepentanoic acid;4,4,5,5,6,6,7,7-octafluoro-2-methyloct-2-enoic acid.
| Compound Name | 5-(dimethylamino)-2-methylidenepentanoic acid;4,4,5,5,6,6,7,7-octafluoro-2-methyloct-2-enoic acid |
|---|---|
| PubChem CID | 87655313 |
| Molecular Formula | C17H23F8NO4 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 5-(dimethylamino)-2-methylidenepentanoic acid;4,4,5,5,6,6,7,7-octafluoro-2-methyloct-2-enoic acid |
| SMILES | C=C(CCCN(C)C)C(=O)O.CC(=CC(F)(F)C(F)(F)C(F)(F)C(C)(F)F)C(=O)O |
| InChI | InChI=1S/C9H8F8O2.C8H15NO2/c1-4(5(18)19)3-7(12,13)9(16,17)8(14,15)6(2,10)11;1-7(8(10)11)5-4-6-9(2)3/h3H,1-2H3,(H,18,19);1,4-6H2,2-3H3,(H,10,11) |
| InChIKey | BYTDPXSJMNKZKR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|