About 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid
2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid (PubChem CID 87787659) has the molecular formula C10H20ClNO2
and a molecular weight of 221.73 g/mol. Its IUPAC name is 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid.
Molecular Properties
| Compound Name | 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid |
| PubChem CID | 87787659 |
| Molecular Formula | C10H20ClNO2 |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid |
| SMILES | C=C(CCN(C)C)C(=O)O.CC(C)Cl |
| InChI | InChI=1S/C7H13NO2.C3H7Cl/c1-6(7(9)10)4-5-8(2)3;1-3(2)4/h1,4-5H2,2-3H3,(H,9,10);3H,1-2H3 |
| InChIKey | DBVMDRAUVUOZFR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid?
The IUPAC name of 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid (CID 87787659) is 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid.
What is the SMILES notation for 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid?
The canonical SMILES for 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid is C=C(CCN(C)C)C(=O)O.CC(C)Cl.
What is the InChIKey of 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid?
The InChIKey is DBVMDRAUVUOZFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.C3H7Cl/c1-6(7(9)10)4-5-8(2)3;1-3(2)4/h1,4-5H2,2-3H3,(H,9,10);3H,1-2H3.
What are the key properties of 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid?
2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid has a molecular weight of 221.73 g/mol, XLogP of 2.21, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid is sourced from PubChem (CID 87787659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).