2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid

C10H20ClNO2 — CID 87787659

IUPAC2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid
SMILESC=C(CCN(C)C)C(=O)O.CC(C)Cl
InChIInChI=1S/C7H13NO2.C3H7Cl/c1-6(7(9)10)4-5-8(2)3;1-3(2)4/h1,4-5H2,2-3H3,(H,9,10);3H,1-2H3
InChIKeyDBVMDRAUVUOZFR-UHFFFAOYSA-N
MW221.73 g/mol
LogP2.21
Rot. Bonds4

About 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid

2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid (PubChem CID 87787659) has the molecular formula C10H20ClNO2 and a molecular weight of 221.73 g/mol. Its IUPAC name is 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid.

Molecular Properties

Compound Name2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid
PubChem CID87787659
Molecular FormulaC10H20ClNO2
Molecular Weight221.73 g/mol
Exact Mass221.12
IUPAC Name2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid
SMILESC=C(CCN(C)C)C(=O)O.CC(C)Cl
InChIInChI=1S/C7H13NO2.C3H7Cl/c1-6(7(9)10)4-5-8(2)3;1-3(2)4/h1,4-5H2,2-3H3,(H,9,10);3H,1-2H3
InChIKeyDBVMDRAUVUOZFR-UHFFFAOYSA-N
XLogP2.21
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.73
LogP ≤ 52.21
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid?
The IUPAC name of 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid (CID 87787659) is 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid.
What is the SMILES notation for 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid?
The canonical SMILES for 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid is C=C(CCN(C)C)C(=O)O.CC(C)Cl.
What is the InChIKey of 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid?
The InChIKey is DBVMDRAUVUOZFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.C3H7Cl/c1-6(7(9)10)4-5-8(2)3;1-3(2)4/h1,4-5H2,2-3H3,(H,9,10);3H,1-2H3.
What are the key properties of 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid?
2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid has a molecular weight of 221.73 g/mol, XLogP of 2.21, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropropane;4-(dimethylamino)-2-methylidenebutanoic acid is sourced from PubChem (CID 87787659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).