C25H50N6O3 — CID 173096321
6-(dimethylamino)-2-methylhex-2-enamide;5-(dimethylamino)-2-methylidenepentanamide;5-(dimethylamino)-2-methylpent-2-enamide (PubChem CID 173096321) has the molecular formula C25H50N6O3 and a molecular weight of 482.71 g/mol. Its IUPAC name is 6-(dimethylamino)-2-methylhex-2-enamide;5-(dimethylamino)-2-methylidenepentanamide;5-(dimethylamino)-2-methylpent-2-enamide.
| Compound Name | 6-(dimethylamino)-2-methylhex-2-enamide;5-(dimethylamino)-2-methylidenepentanamide;5-(dimethylamino)-2-methylpent-2-enamide |
|---|---|
| PubChem CID | 173096321 |
| Molecular Formula | C25H50N6O3 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.39 |
| IUPAC Name | 6-(dimethylamino)-2-methylhex-2-enamide;5-(dimethylamino)-2-methylidenepentanamide;5-(dimethylamino)-2-methylpent-2-enamide |
| SMILES | C=C(CCCN(C)C)C(N)=O.CC(=CCCCN(C)C)C(N)=O.CC(=CCCN(C)C)C(N)=O |
| InChI | InChI=1S/C9H18N2O.2C8H16N2O/c1-8(9(10)12)6-4-5-7-11(2)3;2*1-7(8(9)11)5-4-6-10(2)3/h6H,4-5,7H2,1-3H3,(H2,10,12);5H,4,6H2,1-3H3,(H2,9,11);1,4-6H2,2-3H3,(H2,9,11) |
| InChIKey | UWWIREWSTOESGG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 138.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|