C16H25ClN2O — CID 162054583
chloromethylbenzene;6-(dimethylamino)-2-methylhex-2-enamide (PubChem CID 162054583) has the molecular formula C16H25ClN2O and a molecular weight of 296.84 g/mol. Its IUPAC name is chloromethylbenzene;6-(dimethylamino)-2-methylhex-2-enamide.
| Compound Name | chloromethylbenzene;6-(dimethylamino)-2-methylhex-2-enamide |
|---|---|
| PubChem CID | 162054583 |
| Molecular Formula | C16H25ClN2O |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | chloromethylbenzene;6-(dimethylamino)-2-methylhex-2-enamide |
| SMILES | CC(=CCCCN(C)C)C(N)=O.ClCc1ccccc1 |
| InChI | InChI=1S/C9H18N2O.C7H7Cl/c1-8(9(10)12)6-4-5-7-11(2)3;8-6-7-4-2-1-3-5-7/h6H,4-5,7H2,1-3H3,(H2,10,12);1-5H,6H2 |
| InChIKey | YYZUDQIKUIVMNE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|