About chloromethylbenzene;4-(dimethylamino)-2-methylpent-2-enoic acid
chloromethylbenzene;4-(dimethylamino)-2-methylpent-2-enoic acid (PubChem CID 66617517) has the molecular formula C15H22ClNO2
and a molecular weight of 283.80 g/mol. Its IUPAC name is chloromethylbenzene;4-(dimethylamino)-2-methylpent-2-enoic acid.
Molecular Properties
| Compound Name | chloromethylbenzene;4-(dimethylamino)-2-methylpent-2-enoic acid |
| PubChem CID | 66617517 |
| Molecular Formula | C15H22ClNO2 |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | chloromethylbenzene;4-(dimethylamino)-2-methylpent-2-enoic acid |
| SMILES | CC(=CC(C)N(C)C)C(=O)O.ClCc1ccccc1 |
| InChI | InChI=1S/C8H15NO2.C7H7Cl/c1-6(8(10)11)5-7(2)9(3)4;8-6-7-4-2-1-3-5-7/h5,7H,1-4H3,(H,10,11);1-5H,6H2 |
| InChIKey | VCNQNIKWRFJHDG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze chloromethylbenzene;4-(dimethylamino)-2-methylpent-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethylbenzene;4-(dimethylamino)-2-methylpent-2-enoic acid?
The IUPAC name of chloromethylbenzene;4-(dimethylamino)-2-methylpent-2-enoic acid (CID 66617517) is chloromethylbenzene;4-(dimethylamino)-2-methylpent-2-enoic acid.
What is the SMILES notation for chloromethylbenzene;4-(dimethylamino)-2-methylpent-2-enoic acid?
The canonical SMILES for chloromethylbenzene;4-(dimethylamino)-2-methylpent-2-enoic acid is CC(=CC(C)N(C)C)C(=O)O.ClCc1ccccc1.
What is the InChIKey of chloromethylbenzene;4-(dimethylamino)-2-methylpent-2-enoic acid?
The InChIKey is VCNQNIKWRFJHDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C7H7Cl/c1-6(8(10)11)5-7(2)9(3)4;8-6-7-4-2-1-3-5-7/h5,7H,1-4H3,(H,10,11);1-5H,6H2.
What are the key properties of chloromethylbenzene;4-(dimethylamino)-2-methylpent-2-enoic acid?
chloromethylbenzene;4-(dimethylamino)-2-methylpent-2-enoic acid has a molecular weight of 283.80 g/mol, XLogP of 3.39, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethylbenzene;4-(dimethylamino)-2-methylpent-2-enoic acid is sourced from PubChem (CID 66617517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).