C14H18O2 — CID 67879013
(E)-2,5-dimethyl-6-phenylhex-2-enoic acid (PubChem CID 67879013) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (E)-2,5-dimethyl-6-phenylhex-2-enoic acid.
| Compound Name | (E)-2,5-dimethyl-6-phenylhex-2-enoic acid |
|---|---|
| PubChem CID | 67879013 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (E)-2,5-dimethyl-6-phenylhex-2-enoic acid |
| SMILES | C/C(=C\CC(C)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H18O2/c1-11(8-9-12(2)14(15)16)10-13-6-4-3-5-7-13/h3-7,9,11H,8,10H2,1-2H3,(H,15,16)/b12-9+ |
| InChIKey | FAXLCZNUAUKLGL-FMIVXFBMSA-N |
| XLogP | 3.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|