C19H30O2 — CID 162136934
(5R)-2,5-dimethyl-6-phenylhexan-3-one;3-methylbutan-2-one (PubChem CID 162136934) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (5R)-2,5-dimethyl-6-phenylhexan-3-one;3-methylbutan-2-one.
| Compound Name | (5R)-2,5-dimethyl-6-phenylhexan-3-one;3-methylbutan-2-one |
|---|---|
| PubChem CID | 162136934 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (5R)-2,5-dimethyl-6-phenylhexan-3-one;3-methylbutan-2-one |
| SMILES | CC(=O)C(C)C.CC(C)C(=O)C[C@H](C)Cc1ccccc1 |
| InChI | InChI=1S/C14H20O.C5H10O/c1-11(2)14(15)10-12(3)9-13-7-5-4-6-8-13;1-4(2)5(3)6/h4-8,11-12H,9-10H2,1-3H3;4H,1-3H3/t12-;/m1./s1 |
| InChIKey | ZJKLULOUEKJTTA-UTONKHPSSA-N |
| XLogP | 4.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |