About chloromethylbenzene;1-(dibenzylamino)ethanol
chloromethylbenzene;1-(dibenzylamino)ethanol (PubChem CID 66601956) has the molecular formula C23H26ClNO
and a molecular weight of 367.92 g/mol. Its IUPAC name is chloromethylbenzene;1-(dibenzylamino)ethanol.
Molecular Properties
| Compound Name | chloromethylbenzene;1-(dibenzylamino)ethanol |
| PubChem CID | 66601956 |
| Molecular Formula | C23H26ClNO |
| Molecular Weight | 367.92 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | chloromethylbenzene;1-(dibenzylamino)ethanol |
| SMILES | CC(O)N(Cc1ccccc1)Cc1ccccc1.ClCc1ccccc1 |
| InChI | InChI=1S/C16H19NO.C7H7Cl/c1-14(18)17(12-15-8-4-2-5-9-15)13-16-10-6-3-7-11-16;8-6-7-4-2-1-3-5-7/h2-11,14,18H,12-13H2,1H3;1-5H,6H2 |
| InChIKey | PMNRUYOHIZCLCC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.92 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze chloromethylbenzene;1-(dibenzylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethylbenzene;1-(dibenzylamino)ethanol?
The IUPAC name of chloromethylbenzene;1-(dibenzylamino)ethanol (CID 66601956) is chloromethylbenzene;1-(dibenzylamino)ethanol.
What is the SMILES notation for chloromethylbenzene;1-(dibenzylamino)ethanol?
The canonical SMILES for chloromethylbenzene;1-(dibenzylamino)ethanol is CC(O)N(Cc1ccccc1)Cc1ccccc1.ClCc1ccccc1.
What is the InChIKey of chloromethylbenzene;1-(dibenzylamino)ethanol?
The InChIKey is PMNRUYOHIZCLCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO.C7H7Cl/c1-14(18)17(12-15-8-4-2-5-9-15)13-16-10-6-3-7-11-16;8-6-7-4-2-1-3-5-7/h2-11,14,18H,12-13H2,1H3;1-5H,6H2.
What are the key properties of chloromethylbenzene;1-(dibenzylamino)ethanol?
chloromethylbenzene;1-(dibenzylamino)ethanol has a molecular weight of 367.92 g/mol, XLogP of 5.45, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethylbenzene;1-(dibenzylamino)ethanol is sourced from PubChem (CID 66601956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).