C33H56N4O2 — CID 19757907
1-[benzyl-[4-[7-[4-[benzyl(1-hydroxyethyl)amino]butylamino]heptylamino]butyl]amino]ethanol (PubChem CID 19757907) has the molecular formula C33H56N4O2 and a molecular weight of 540.84 g/mol. Its IUPAC name is 1-[benzyl-[4-[7-[4-[benzyl(1-hydroxyethyl)amino]butylamino]heptylamino]butyl]amino]ethanol.
| Compound Name | 1-[benzyl-[4-[7-[4-[benzyl(1-hydroxyethyl)amino]butylamino]heptylamino]butyl]amino]ethanol |
|---|---|
| PubChem CID | 19757907 |
| Molecular Formula | C33H56N4O2 |
| Molecular Weight | 540.84 g/mol |
| Exact Mass | 540.44 |
| IUPAC Name | 1-[benzyl-[4-[7-[4-[benzyl(1-hydroxyethyl)amino]butylamino]heptylamino]butyl]amino]ethanol |
| SMILES | CC(O)N(CCCCNCCCCCCCNCCCCN(Cc1ccccc1)C(C)O)Cc1ccccc1 |
| InChI | InChI=1S/C33H56N4O2/c1-30(38)36(28-32-18-8-6-9-19-32)26-16-14-24-34-22-12-4-3-5-13-23-35-25-15-17-27-37(31(2)39)29-33-20-10-7-11-21-33/h6-11,18-21,30-31,34-35,38-39H,3-5,12-17,22-29H2,1-2H3 |
| InChIKey | QUHXZRPKGNAHMR-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.84 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|