C19H34N2 — CID 62423460
N'-benzyl-N-(2-methylpropyl)-N'-propan-2-ylpentane-1,5-diamine (PubChem CID 62423460) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is N'-benzyl-N-(2-methylpropyl)-N'-propan-2-ylpentane-1,5-diamine.
| Compound Name | N'-benzyl-N-(2-methylpropyl)-N'-propan-2-ylpentane-1,5-diamine |
|---|---|
| PubChem CID | 62423460 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | N'-benzyl-N-(2-methylpropyl)-N'-propan-2-ylpentane-1,5-diamine |
| SMILES | CC(C)CNCCCCCN(Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C19H34N2/c1-17(2)15-20-13-9-6-10-14-21(18(3)4)16-19-11-7-5-8-12-19/h5,7-8,11-12,17-18,20H,6,9-10,13-16H2,1-4H3 |
| InChIKey | BOBJZLKCXZZNES-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|