C19H34N2 — CID 62423459
N'-benzyl-N-tert-butyl-N'-propan-2-ylpentane-1,5-diamine (PubChem CID 62423459) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is N'-benzyl-N-tert-butyl-N'-propan-2-ylpentane-1,5-diamine.
| Compound Name | N'-benzyl-N-tert-butyl-N'-propan-2-ylpentane-1,5-diamine |
|---|---|
| PubChem CID | 62423459 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | N'-benzyl-N-tert-butyl-N'-propan-2-ylpentane-1,5-diamine |
| SMILES | CC(C)N(CCCCCNC(C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C19H34N2/c1-17(2)21(16-18-12-8-6-9-13-18)15-11-7-10-14-20-19(3,4)5/h6,8-9,12-13,17,20H,7,10-11,14-16H2,1-5H3 |
| InChIKey | QXOPUKDRNUKPGU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|