C37H64N4S2 — CID 57303556
1-[4-(3-phenylpropylamino)butyl-[7-[4-(3-phenylpropylamino)butyl-(1-sulfanylethyl)amino]heptyl]amino]ethanethiol (PubChem CID 57303556) has the molecular formula C37H64N4S2 and a molecular weight of 629.08 g/mol. Its IUPAC name is 1-[4-(3-phenylpropylamino)butyl-[7-[4-(3-phenylpropylamino)butyl-(1-sulfanylethyl)amino]heptyl]amino]ethanethiol.
| Compound Name | 1-[4-(3-phenylpropylamino)butyl-[7-[4-(3-phenylpropylamino)butyl-(1-sulfanylethyl)amino]heptyl]amino]ethanethiol |
|---|---|
| PubChem CID | 57303556 |
| Molecular Formula | C37H64N4S2 |
| Molecular Weight | 629.08 g/mol |
| Exact Mass | 628.46 |
| IUPAC Name | 1-[4-(3-phenylpropylamino)butyl-[7-[4-(3-phenylpropylamino)butyl-(1-sulfanylethyl)amino]heptyl]amino]ethanethiol |
| SMILES | CC(S)N(CCCCCCCN(CCCCNCCCc1ccccc1)C(C)S)CCCCNCCCc1ccccc1 |
| InChI | InChI=1S/C37H64N4S2/c1-34(42)40(32-16-12-26-38-28-18-24-36-20-8-6-9-21-36)30-14-4-3-5-15-31-41(35(2)43)33-17-13-27-39-29-19-25-37-22-10-7-11-23-37/h6-11,20-23,34-35,38-39,42-43H,3-5,12-19,24-33H2,1-2H3 |
| InChIKey | WITVXLCJHICBFY-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.08 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|