C16H20F9NO4S — CID 87844235
2-methylbuta-1,3-diene;2-methylidene-5-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]pentanoic acid (PubChem CID 87844235) has the molecular formula C16H20F9NO4S and a molecular weight of 493.39 g/mol. Its IUPAC name is 2-methylbuta-1,3-diene;2-methylidene-5-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]pentanoic acid.
| Compound Name | 2-methylbuta-1,3-diene;2-methylidene-5-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 87844235 |
| Molecular Formula | C16H20F9NO4S |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 2-methylbuta-1,3-diene;2-methylidene-5-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]pentanoic acid |
| SMILES | C=C(CCCN(C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O.C=CC(=C)C |
| InChI | InChI=1S/C11H12F9NO4S.C5H8/c1-6(7(22)23)4-3-5-21(2)26(24,25)11(19,20)9(14,15)8(12,13)10(16,17)18;1-4-5(2)3/h1,3-5H2,2H3,(H,22,23);4H,1-2H2,3H3 |
| InChIKey | HJPBDGDPFFMIKL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|