C10H13F9N2O3S — CID 86657621
N-[2-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]ethyl]propanamide (PubChem CID 86657621) has the molecular formula C10H13F9N2O3S and a molecular weight of 412.27 g/mol. Its IUPAC name is N-[2-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]ethyl]propanamide.
| Compound Name | N-[2-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 86657621 |
| Molecular Formula | C10H13F9N2O3S |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | N-[2-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]ethyl]propanamide |
| SMILES | CCC(=O)NCCN(C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13F9N2O3S/c1-3-6(22)20-4-5-21(2)25(23,24)10(18,19)8(13,14)7(11,12)9(15,16)17/h3-5H2,1-2H3,(H,20,22) |
| InChIKey | BKCRWQGYLZYQMJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|