C16H16F18N2O6S2 — CID 139990724
ethyl 3-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-2-[[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]methyl]propanoate (PubChem CID 139990724) has the molecular formula C16H16F18N2O6S2 and a molecular weight of 738.41 g/mol. Its IUPAC name is ethyl 3-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-2-[[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]methyl]propanoate.
| Compound Name | ethyl 3-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-2-[[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]methyl]propanoate |
|---|---|
| PubChem CID | 139990724 |
| Molecular Formula | C16H16F18N2O6S2 |
| Molecular Weight | 738.41 g/mol |
| Exact Mass | 738.02 |
| IUPAC Name | ethyl 3-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]-2-[[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]methyl]propanoate |
| SMILES | CCOC(=O)C(CN(C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CN(C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H16F18N2O6S2/c1-4-42-8(37)7(5-35(2)43(38,39)15(31,32)11(21,22)9(17,18)13(25,26)27)6-36(3)44(40,41)16(33,34)12(23,24)10(19,20)14(28,29)30/h7H,4-6H2,1-3H3 |
| InChIKey | KPGVKYXMUSQLGN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|