C17H12F21NO4S — CID 141257249
ethyl 3-fluoro-3-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl(propyl)amino]-2-(trifluoromethyl)prop-2-enoate (PubChem CID 141257249) has the molecular formula C17H12F21NO4S and a molecular weight of 725.31 g/mol. Its IUPAC name is ethyl 3-fluoro-3-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl(propyl)amino]-2-(trifluoromethyl)prop-2-enoate.
| Compound Name | ethyl 3-fluoro-3-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl(propyl)amino]-2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 141257249 |
| Molecular Formula | C17H12F21NO4S |
| Molecular Weight | 725.31 g/mol |
| Exact Mass | 725.02 |
| IUPAC Name | ethyl 3-fluoro-3-[1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl(propyl)amino]-2-(trifluoromethyl)prop-2-enoate |
| SMILES | CCCN(C(F)=C(C(=O)OCC)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H12F21NO4S/c1-3-5-39(7(18)6(9(19,20)21)8(40)43-4-2)44(41,42)17(37,38)15(32,33)13(28,29)11(24,25)10(22,23)12(26,27)14(30,31)16(34,35)36/h3-5H2,1-2H3 |
| InChIKey | YWNWFRKHVKRILB-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.31 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|